C24H19ClN4O4S — CID 53306715
1-[1-[(2-chlorophenyl)methyl]-2,3-dioxoindol-5-yl]-3-[(2-methoxyphenyl)carbamothioyl]urea (PubChem CID 53306715) has the molecular formula C24H19ClN4O4S and a molecular weight of 494.96 g/mol. Its IUPAC name is 1-[1-[(2-chlorophenyl)methyl]-2,3-dioxoindol-5-yl]-3-[(2-methoxyphenyl)carbamothioyl]urea.
| Compound Name | 1-[1-[(2-chlorophenyl)methyl]-2,3-dioxoindol-5-yl]-3-[(2-methoxyphenyl)carbamothioyl]urea |
|---|---|
| PubChem CID | 53306715 |
| Molecular Formula | C24H19ClN4O4S |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 1-[1-[(2-chlorophenyl)methyl]-2,3-dioxoindol-5-yl]-3-[(2-methoxyphenyl)carbamothioyl]urea |
| SMILES | COc1ccccc1NC(=S)NC(=O)Nc1ccc2c(c1)C(=O)C(=O)N2Cc1ccccc1Cl |
| InChI | InChI=1S/C24H19ClN4O4S/c1-33-20-9-5-4-8-18(20)27-24(34)28-23(32)26-15-10-11-19-16(12-15)21(30)22(31)29(19)13-14-6-2-3-7-17(14)25/h2-12H,13H2,1H3,(H3,26,27,28,32,34) |
| InChIKey | STIDCVUQAMTKFR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|