C31H31N4O8PS — CID 53322560
benzyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-thiophen-3-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 53322560) has the molecular formula C31H31N4O8PS and a molecular weight of 650.65 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-thiophen-3-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-thiophen-3-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 53322560 |
| Molecular Formula | C31H31N4O8PS |
| Molecular Weight | 650.65 g/mol |
| Exact Mass | 650.16 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-thiophen-3-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H](n2ccc3c(-c4ccsc4)ncnc32)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H31N4O8PS/c1-20(31(38)40-16-21-8-4-2-5-9-21)34-44(39,43-23-10-6-3-7-11-23)41-17-25-27(36)28(37)30(42-25)35-14-12-24-26(22-13-15-45-18-22)32-19-33-29(24)35/h2-15,18-20,25,27-28,30,36-37H,16-17H2,1H3,(H,34,39)/t20-,25+,27+,28+,30+,44?/m0/s1 |
| InChIKey | ZQBUWQPJHPZGFT-NVFGFQRYSA-N |
| XLogP | 4.70 |
| TPSA | 154.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|