C27H34N5O8P — CID 166627319
pentyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166627319) has the molecular formula C27H34N5O8P and a molecular weight of 587.57 g/mol. Its IUPAC name is pentyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | pentyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166627319 |
| Molecular Formula | C27H34N5O8P |
| Molecular Weight | 587.57 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | pentyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(N[C@@H](C)C(=O)OCCCCC)Oc2ccccc2)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C27H34N5O8P/c1-4-6-10-15-37-25(34)18(3)31-41(36,40-19-11-8-7-9-12-19)38-16-21-22(33)27(35,5-2)26(39-21)32-14-13-20-23(28)29-17-30-24(20)32/h2,7-9,11-14,17-18,21-22,26,33,35H,4,6,10,15-16H2,1,3H3,(H,31,36)(H2,28,29,30)/t18-,21+,22+,26+,27+,41?/m0/s1 |
| InChIKey | KVZUXWNMVFTIBL-RZWKWUDSSA-N |
| XLogP | 2.55 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|