C15H21N3O — CID 53341189
1,1,2,2,3,3,4,5,5,5-decadeuterio-4-N-[5-deuterio-6-(trideuteriomethoxy)quinolin-8-yl]pentane-1,4-diamine (PubChem CID 53341189) has the molecular formula C15H21N3O and a molecular weight of 273.44 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,5,5,5-decadeuterio-4-N-[5-deuterio-6-(trideuteriomethoxy)quinolin-8-yl]pentane-1,4-diamine.
| Compound Name | 1,1,2,2,3,3,4,5,5,5-decadeuterio-4-N-[5-deuterio-6-(trideuteriomethoxy)quinolin-8-yl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 53341189 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.26 |
| IUPAC Name | 1,1,2,2,3,3,4,5,5,5-decadeuterio-4-N-[5-deuterio-6-(trideuteriomethoxy)quinolin-8-yl]pentane-1,4-diamine |
| SMILES | [2H]c1c(OC([2H])([2H])[2H])cc(NC([2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N)c2ncccc12 |
| InChI | InChI=1S/C15H21N3O/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14/h4,6,8-11,18H,3,5,7,16H2,1-2H3/i1D3,2D3,3D2,5D2,7D2,9D,11D |
| InChIKey | INDBQLZJXZLFIT-DEDDRVJCSA-N |
| XLogP | 2.78 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |