C20H40N5O7+ — CID 53343856
2-hydroxyethyl-dimethyl-[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]ethyl]azanium (PubChem CID 53343856) has the molecular formula C20H40N5O7+ and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-hydroxyethyl-dimethyl-[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]ethyl]azanium.
| Compound Name | 2-hydroxyethyl-dimethyl-[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 53343856 |
| Molecular Formula | C20H40N5O7+ |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 2-hydroxyethyl-dimethyl-[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]ethyl]azanium |
| SMILES | C[N+](C)(CCO)CCN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H39N5O7/c1-25(2,13-14-26)12-11-21-3-5-22(15-18(27)28)7-9-24(17-20(31)32)10-8-23(6-4-21)16-19(29)30/h26H,3-17H2,1-2H3,(H2-,27,28,29,30,31,32)/p+1 |
| InChIKey | PEBLXZNJPMZQLT-UHFFFAOYSA-O |
| XLogP | -2.47 |
| TPSA | 145.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|