C28H21ClN7O5P — CID 53349242
1-[(6-chloro-3-pyridinyl)methyl]-5-[[diphenoxyphosphoryl-(4-nitrophenyl)methyl]amino]triazole-4-carbonitrile (PubChem CID 53349242) has the molecular formula C28H21ClN7O5P and a molecular weight of 601.95 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-5-[[diphenoxyphosphoryl-(4-nitrophenyl)methyl]amino]triazole-4-carbonitrile.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-5-[[diphenoxyphosphoryl-(4-nitrophenyl)methyl]amino]triazole-4-carbonitrile |
|---|---|
| PubChem CID | 53349242 |
| Molecular Formula | C28H21ClN7O5P |
| Molecular Weight | 601.95 g/mol |
| Exact Mass | 601.10 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-5-[[diphenoxyphosphoryl-(4-nitrophenyl)methyl]amino]triazole-4-carbonitrile |
| SMILES | N#Cc1nnn(Cc2ccc(Cl)nc2)c1NC(c1ccc([N+](=O)[O-])cc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C28H21ClN7O5P/c29-26-16-11-20(18-31-26)19-35-27(25(17-30)33-34-35)32-28(21-12-14-22(15-13-21)36(37)38)42(39,40-23-7-3-1-4-8-23)41-24-9-5-2-6-10-24/h1-16,18,28,32H,19H2 |
| InChIKey | TWCUFSKQYLAHJH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 158.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.95 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|