C24H20ClNS2 — CID 53355105
6'-chloro-3',3'-diphenylspiro[1,3-dithiane-2,4'-quinoline] (PubChem CID 53355105) has the molecular formula C24H20ClNS2 and a molecular weight of 422.02 g/mol. Its IUPAC name is 6'-chloro-3',3'-diphenylspiro[1,3-dithiane-2,4'-quinoline].
| Compound Name | 6'-chloro-3',3'-diphenylspiro[1,3-dithiane-2,4'-quinoline] |
|---|---|
| PubChem CID | 53355105 |
| Molecular Formula | C24H20ClNS2 |
| Molecular Weight | 422.02 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 6'-chloro-3',3'-diphenylspiro[1,3-dithiane-2,4'-quinoline] |
| SMILES | Clc1ccc2c(c1)C1(SCCCS1)C(c1ccccc1)(c1ccccc1)C=N2 |
| InChI | InChI=1S/C24H20ClNS2/c25-20-12-13-22-21(16-20)24(27-14-7-15-28-24)23(17-26-22,18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-13,16-17H,7,14-15H2 |
| InChIKey | DGQHQGNEKKBNSN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.02 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |