C19H20BrN3O — CID 53362137
2-(4-bromophenyl)-N-(1,3-dimethylimidazolidin-2-ylidene)-2-phenylacetamide (PubChem CID 53362137) has the molecular formula C19H20BrN3O and a molecular weight of 386.29 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-(1,3-dimethylimidazolidin-2-ylidene)-2-phenylacetamide.
| Compound Name | 2-(4-bromophenyl)-N-(1,3-dimethylimidazolidin-2-ylidene)-2-phenylacetamide |
|---|---|
| PubChem CID | 53362137 |
| Molecular Formula | C19H20BrN3O |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-(4-bromophenyl)-N-(1,3-dimethylimidazolidin-2-ylidene)-2-phenylacetamide |
| SMILES | CN1CCN(C)C1=NC(=O)C(c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H20BrN3O/c1-22-12-13-23(2)19(22)21-18(24)17(14-6-4-3-5-7-14)15-8-10-16(20)11-9-15/h3-11,17H,12-13H2,1-2H3 |
| InChIKey | RSNNTUWUQSLZRJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|