C20H21NO5S — CID 53375615
methyl (12S,12aS)-12-ethylsulfonyl-3-oxo-1,2,5,12-tetrahydronaphtho[2,3-f]indolizine-12a-carboxylate (PubChem CID 53375615) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is methyl (12S,12aS)-12-ethylsulfonyl-3-oxo-1,2,5,12-tetrahydronaphtho[2,3-f]indolizine-12a-carboxylate.
| Compound Name | methyl (12S,12aS)-12-ethylsulfonyl-3-oxo-1,2,5,12-tetrahydronaphtho[2,3-f]indolizine-12a-carboxylate |
|---|---|
| PubChem CID | 53375615 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | methyl (12S,12aS)-12-ethylsulfonyl-3-oxo-1,2,5,12-tetrahydronaphtho[2,3-f]indolizine-12a-carboxylate |
| SMILES | CCS(=O)(=O)[C@H]1c2cc3ccccc3cc2CN2C(=O)CC[C@]12C(=O)OC |
| InChI | InChI=1S/C20H21NO5S/c1-3-27(24,25)18-16-11-14-7-5-4-6-13(14)10-15(16)12-21-17(22)8-9-20(18,21)19(23)26-2/h4-7,10-11,18H,3,8-9,12H2,1-2H3/t18-,20+/m0/s1 |
| InChIKey | GEXLPYZOLRJPCN-AZUAARDMSA-N |
| XLogP | 2.36 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |