C20H20N2O4S2 — CID 53377403
2-(benzoylcarbamothioylamino)spiro[4,7-dihydrothieno[2,3-c]pyran-5,1'-cyclopentane]-3-carboxylic acid (PubChem CID 53377403) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-(benzoylcarbamothioylamino)spiro[4,7-dihydrothieno[2,3-c]pyran-5,1'-cyclopentane]-3-carboxylic acid.
| Compound Name | 2-(benzoylcarbamothioylamino)spiro[4,7-dihydrothieno[2,3-c]pyran-5,1'-cyclopentane]-3-carboxylic acid |
|---|---|
| PubChem CID | 53377403 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-(benzoylcarbamothioylamino)spiro[4,7-dihydrothieno[2,3-c]pyran-5,1'-cyclopentane]-3-carboxylic acid |
| SMILES | O=C(NC(=S)Nc1sc2c(c1C(=O)O)CC1(CCCC1)OC2)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O4S2/c23-16(12-6-2-1-3-7-12)21-19(27)22-17-15(18(24)25)13-10-20(8-4-5-9-20)26-11-14(13)28-17/h1-3,6-7H,4-5,8-11H2,(H,24,25)(H2,21,22,23,27) |
| InChIKey | VNNQNVOTFSXEHY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|