C20H17F6NO2S — CID 53386966
[(3R,5S)-3,5-bis[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanethiol (PubChem CID 53386966) has the molecular formula C20H17F6NO2S and a molecular weight of 449.42 g/mol. Its IUPAC name is [(3R,5S)-3,5-bis[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanethiol.
| Compound Name | [(3R,5S)-3,5-bis[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanethiol |
|---|---|
| PubChem CID | 53386966 |
| Molecular Formula | C20H17F6NO2S |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | [(3R,5S)-3,5-bis[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanethiol |
| SMILES | FC(F)(F)c1ccc([C@H]2OCC3(CS)CO[C@@H](c4ccc(C(F)(F)F)cc4)N23)cc1 |
| InChI | InChI=1S/C20H17F6NO2S/c21-19(22,23)14-5-1-12(2-6-14)16-27-17(29-10-18(27,11-30)9-28-16)13-3-7-15(8-4-13)20(24,25)26/h1-8,16-17,30H,9-11H2/t16-,17+,18? |
| InChIKey | WXVVUKXHIANNFL-JWTNVVGKSA-N |
| XLogP | 5.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|