C19H17F4NO3 — CID 70902479
[(3S,5S,7aR)-5-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol (PubChem CID 70902479) has the molecular formula C19H17F4NO3 and a molecular weight of 383.34 g/mol. Its IUPAC name is [(3S,5S,7aR)-5-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol.
| Compound Name | [(3S,5S,7aR)-5-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol |
|---|---|
| PubChem CID | 70902479 |
| Molecular Formula | C19H17F4NO3 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | [(3S,5S,7aR)-5-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol |
| SMILES | OC[C@@]12CO[C@@H](c3ccc(F)cc3)N1[C@H](c1ccc(C(F)(F)F)cc1)OC2 |
| InChI | InChI=1S/C19H17F4NO3/c20-15-7-3-13(4-8-15)17-24-16(26-10-18(24,9-25)11-27-17)12-1-5-14(6-2-12)19(21,22)23/h1-8,16-17,25H,9-11H2/t16-,17-,18+/m0/s1 |
| InChIKey | XCCOUOGKOQIHBP-OKZBNKHCSA-N |
| XLogP | 3.64 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |