C20H17F6NO3 — CID 89362800
[(3R,5R)-3,5-bis[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol (PubChem CID 89362800) has the molecular formula C20H17F6NO3 and a molecular weight of 433.35 g/mol. Its IUPAC name is [(3R,5R)-3,5-bis[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol.
| Compound Name | [(3R,5R)-3,5-bis[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol |
|---|---|
| PubChem CID | 89362800 |
| Molecular Formula | C20H17F6NO3 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | [(3R,5R)-3,5-bis[4-(trifluoromethyl)phenyl]-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol |
| SMILES | OCC12CO[C@H](c3ccc(C(F)(F)F)cc3)N1[C@@H](c1ccc(C(F)(F)F)cc1)OC2 |
| InChI | InChI=1S/C20H17F6NO3/c21-19(22,23)14-5-1-12(2-6-14)16-27-17(30-11-18(27,9-28)10-29-16)13-3-7-15(8-4-13)20(24,25)26/h1-8,16-17,28H,9-11H2/t16-,17-/m1/s1 |
| InChIKey | WUMDWRVUQCOHGV-IAGOWNOFSA-N |
| XLogP | 4.52 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |