C11H16F2NO2P — CID 53392367
N-[difluoromethyl(propan-2-yloxy)phosphoryl]-1-phenylmethanamine (PubChem CID 53392367) has the molecular formula C11H16F2NO2P and a molecular weight of 263.22 g/mol. Its IUPAC name is N-[difluoromethyl(propan-2-yloxy)phosphoryl]-1-phenylmethanamine.
| Compound Name | N-[difluoromethyl(propan-2-yloxy)phosphoryl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 53392367 |
| Molecular Formula | C11H16F2NO2P |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-[difluoromethyl(propan-2-yloxy)phosphoryl]-1-phenylmethanamine |
| SMILES | CC(C)OP(=O)(NCc1ccccc1)C(F)F |
| InChI | InChI=1S/C11H16F2NO2P/c1-9(2)16-17(15,11(12)13)14-8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3,(H,14,15) |
| InChIKey | XIBQHPUHKGKTNN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|