C5H7BrN2O — CID 53407331
2-(3-bromo-1,2-oxazol-5-yl)ethanamine (PubChem CID 53407331) has the molecular formula C5H7BrN2O and a molecular weight of 191.03 g/mol. Its IUPAC name is 2-(3-bromo-1,2-oxazol-5-yl)ethanamine.
| Compound Name | 2-(3-bromo-1,2-oxazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 53407331 |
| Molecular Formula | C5H7BrN2O |
| Molecular Weight | 191.03 g/mol |
| Exact Mass | 189.97 |
| IUPAC Name | 2-(3-bromo-1,2-oxazol-5-yl)ethanamine |
| SMILES | NCCc1cc(Br)no1 |
| InChI | InChI=1S/C5H7BrN2O/c6-5-3-4(1-2-7)9-8-5/h3H,1-2,7H2 |
| InChIKey | QEIHHMYEMPGRHM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.03 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |