About dichloromethoxyphosphane
dichloromethoxyphosphane (PubChem CID 53411167) has the molecular formula CH3Cl2OP
and a molecular weight of 132.91 g/mol. Its IUPAC name is dichloromethoxyphosphane.
Molecular Properties
| Compound Name | dichloromethoxyphosphane |
| PubChem CID | 53411167 |
| Molecular Formula | CH3Cl2OP |
| Molecular Weight | 132.91 g/mol |
| Exact Mass | 131.93 |
| IUPAC Name | dichloromethoxyphosphane |
| SMILES | POC(Cl)Cl |
| InChI | InChI=1S/CH3Cl2OP/c2-1(3)4-5/h1H,5H2 |
| InChIKey | DXFAFXZDHJVGHP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.91 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloromethoxyphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethoxyphosphane?
The IUPAC name of dichloromethoxyphosphane (CID 53411167) is dichloromethoxyphosphane.
What is the SMILES notation for dichloromethoxyphosphane?
The canonical SMILES for dichloromethoxyphosphane is POC(Cl)Cl.
What is the InChIKey of dichloromethoxyphosphane?
The InChIKey is DXFAFXZDHJVGHP-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3Cl2OP/c2-1(3)4-5/h1H,5H2.
What are the key properties of dichloromethoxyphosphane?
dichloromethoxyphosphane has a molecular weight of 132.91 g/mol, XLogP of 1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethoxyphosphane is sourced from PubChem (CID 53411167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).