C16H17N3OS — CID 53423015
2-(3aH-benzimidazol-2-ylsulfinylmethyl)-N,N-dimethylaniline (PubChem CID 53423015) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-(3aH-benzimidazol-2-ylsulfinylmethyl)-N,N-dimethylaniline.
| Compound Name | 2-(3aH-benzimidazol-2-ylsulfinylmethyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 53423015 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-(3aH-benzimidazol-2-ylsulfinylmethyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1CS(=O)C1=NC2C=CC=CC2=N1 |
| InChI | InChI=1S/C16H17N3OS/c1-19(2)15-10-6-3-7-12(15)11-21(20)16-17-13-8-4-5-9-14(13)18-16/h3-10,13H,11H2,1-2H3 |
| InChIKey | PJTUQIQNDQAIPK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |