C15H26S — CID 53439773
3,7,11-trimethyldodeca-2,6,10-triene-1-thiol (PubChem CID 53439773) has the molecular formula C15H26S and a molecular weight of 238.44 g/mol. Its IUPAC name is 3,7,11-trimethyldodeca-2,6,10-triene-1-thiol.
| Compound Name | 3,7,11-trimethyldodeca-2,6,10-triene-1-thiol |
|---|---|
| PubChem CID | 53439773 |
| Molecular Formula | C15H26S |
| Molecular Weight | 238.44 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 3,7,11-trimethyldodeca-2,6,10-triene-1-thiol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCS |
| InChI | InChI=1S/C15H26S/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3 |
| InChIKey | CJWPDADGDASKGI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|