C10H27N3O3Si — CID 53446485
N'-[2-[propyl(trimethoxysilyl)amino]ethyl]ethane-1,2-diamine (PubChem CID 53446485) has the molecular formula C10H27N3O3Si and a molecular weight of 265.43 g/mol. Its IUPAC name is N'-[2-[propyl(trimethoxysilyl)amino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[propyl(trimethoxysilyl)amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 53446485 |
| Molecular Formula | C10H27N3O3Si |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N'-[2-[propyl(trimethoxysilyl)amino]ethyl]ethane-1,2-diamine |
| SMILES | CCCN(CCNCCN)[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H27N3O3Si/c1-5-9-13(10-8-12-7-6-11)17(14-2,15-3)16-4/h12H,5-11H2,1-4H3 |
| InChIKey | SJTQFJIPZFYYIV-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|