C11H18N2O8S — CID 53464617
(4R)-2-[[(2R,3R,4S,5S)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]carbamoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 53464617) has the molecular formula C11H18N2O8S and a molecular weight of 338.34 g/mol. Its IUPAC name is (4R)-2-[[(2R,3R,4S,5S)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]carbamoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-2-[[(2R,3R,4S,5S)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]carbamoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 53464617 |
| Molecular Formula | C11H18N2O8S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (4R)-2-[[(2R,3R,4S,5S)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]carbamoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C[C@H](NC(=O)C1N[C@H](C(=O)O)CS1)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C11H18N2O8S/c14-1-4(7(17)8(18)6(16)2-15)12-9(19)10-13-5(3-22-10)11(20)21/h1,4-8,10,13,15-18H,2-3H2,(H,12,19)(H,20,21)/t4-,5-,6-,7+,8+,10?/m0/s1 |
| InChIKey | IJFQVZMBAOTXBK-MHXDOPKMSA-N |
| XLogP | -4.14 |
| TPSA | 176.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | -4.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|