C21H20ClN3O3S — CID 53470585
3-chloro-4-[[4-(3-phenylpropylamino)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 53470585) has the molecular formula C21H20ClN3O3S and a molecular weight of 429.93 g/mol. Its IUPAC name is 3-chloro-4-[[4-(3-phenylpropylamino)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 3-chloro-4-[[4-(3-phenylpropylamino)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 53470585 |
| Molecular Formula | C21H20ClN3O3S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 3-chloro-4-[[4-(3-phenylpropylamino)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(/N=N/c2ccc(NCCCc3ccccc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H20ClN3O3S/c22-20-15-19(29(26,27)28)12-13-21(20)25-24-18-10-8-17(9-11-18)23-14-4-7-16-5-2-1-3-6-16/h1-3,5-6,8-13,15,23H,4,7,14H2,(H,26,27,28)/b25-24+ |
| InChIKey | WOPMNRDTNBDDRQ-OCOZRVBESA-N |
| XLogP | 6.05 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|