C11H7F13N2O — CID 5365735
N-[(Z)-[(E)-but-2-enylidene]amino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide (PubChem CID 5365735) has the molecular formula C11H7F13N2O and a molecular weight of 430.16 g/mol. Its IUPAC name is N-[(Z)-[(E)-but-2-enylidene]amino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide.
| Compound Name | N-[(Z)-[(E)-but-2-enylidene]amino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
|---|---|
| PubChem CID | 5365735 |
| Molecular Formula | C11H7F13N2O |
| Molecular Weight | 430.16 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | N-[(Z)-[(E)-but-2-enylidene]amino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
| SMILES | C/C=C/C=N\NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F13N2O/c1-2-3-4-25-26-5(27)6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h2-4H,1H3,(H,26,27)/b3-2+,25-4- |
| InChIKey | UTPIUWDVDSEPNW-OMGQZGQGSA-N |
| XLogP | 4.40 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.16 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|