C14H16O2 — CID 5366271
2-[(1E,7E)-nona-1,7-dien-3,5-diynyl]oxan-3-ol (PubChem CID 5366271) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[(1E,7E)-nona-1,7-dien-3,5-diynyl]oxan-3-ol.
| Compound Name | 2-[(1E,7E)-nona-1,7-dien-3,5-diynyl]oxan-3-ol |
|---|---|
| PubChem CID | 5366271 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 2-[(1E,7E)-nona-1,7-dien-3,5-diynyl]oxan-3-ol |
| SMILES | C/C=C/C#CC#C/C=C/C1OCCCC1O |
| InChI | InChI=1S/C14H16O2/c1-2-3-4-5-6-7-8-11-14-13(15)10-9-12-16-14/h2-3,8,11,13-15H,9-10,12H2,1H3/b3-2+,11-8+ |
| InChIKey | HAMPDEKVXLFKLK-FWTOVJONSA-N |
| XLogP | 1.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|