C10H7F2NO5S — CID 5369227
(E)-4-(2-fluoro-4-fluorosulfonylanilino)-4-oxobut-2-enoic acid (PubChem CID 5369227) has the molecular formula C10H7F2NO5S and a molecular weight of 291.23 g/mol. Its IUPAC name is (E)-4-(2-fluoro-4-fluorosulfonylanilino)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(2-fluoro-4-fluorosulfonylanilino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 5369227 |
| Molecular Formula | C10H7F2NO5S |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | (E)-4-(2-fluoro-4-fluorosulfonylanilino)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(S(=O)(=O)F)cc1F |
| InChI | InChI=1S/C10H7F2NO5S/c11-7-5-6(19(12,17)18)1-2-8(7)13-9(14)3-4-10(15)16/h1-5H,(H,13,14)(H,15,16)/b4-3+ |
| InChIKey | DJZDCJJSHAXVAE-ONEGZZNKSA-N |
| XLogP | 1.06 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|