C17H16ClN3OS — CID 5369678
N-(2-benzoyl-4-chlorophenyl)pyrazolidine-1-carbothioamide (PubChem CID 5369678) has the molecular formula C17H16ClN3OS and a molecular weight of 345.86 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)pyrazolidine-1-carbothioamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)pyrazolidine-1-carbothioamide |
|---|---|
| PubChem CID | 5369678 |
| Molecular Formula | C17H16ClN3OS |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)pyrazolidine-1-carbothioamide |
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1NC(=S)N1CCCN1 |
| InChI | InChI=1S/C17H16ClN3OS/c18-13-7-8-15(20-17(23)21-10-4-9-19-21)14(11-13)16(22)12-5-2-1-3-6-12/h1-3,5-8,11,19H,4,9-10H2,(H,20,23) |
| InChIKey | VLHYLPGYYZLSAH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|