C30H60O5Si3 — CID 5375250
methyl 7-trimethylsilyloxy-7-[5-trimethylsilyloxy-2-[(E)-1-trimethylsilyloxyoct-3-enyl]cyclopent-2-en-1-yl]heptanoate (PubChem CID 5375250) has the molecular formula C30H60O5Si3 and a molecular weight of 585.06 g/mol. Its IUPAC name is methyl 7-trimethylsilyloxy-7-[5-trimethylsilyloxy-2-[(E)-1-trimethylsilyloxyoct-3-enyl]cyclopent-2-en-1-yl]heptanoate.
| Compound Name | methyl 7-trimethylsilyloxy-7-[5-trimethylsilyloxy-2-[(E)-1-trimethylsilyloxyoct-3-enyl]cyclopent-2-en-1-yl]heptanoate |
|---|---|
| PubChem CID | 5375250 |
| Molecular Formula | C30H60O5Si3 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.37 |
| IUPAC Name | methyl 7-trimethylsilyloxy-7-[5-trimethylsilyloxy-2-[(E)-1-trimethylsilyloxyoct-3-enyl]cyclopent-2-en-1-yl]heptanoate |
| SMILES | CCCC/C=C/CC(O[Si](C)(C)C)C1=CCC(O[Si](C)(C)C)C1C(CCCCCC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C30H60O5Si3/c1-12-13-14-15-17-20-26(33-36(3,4)5)25-23-24-28(35-38(9,10)11)30(25)27(34-37(6,7)8)21-18-16-19-22-29(31)32-2/h15,17,23,26-28,30H,12-14,16,18-22,24H2,1-11H3/b17-15+ |
| InChIKey | VVMPRNOOCKXQBE-BMRADRMJSA-N |
| XLogP | 8.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|