C12H8N2O4S2 — CID 5381024
3-[(E)-3-amino-2-cyano-3-oxoprop-1-enyl]-1-benzothiophene-2-sulfonic acid (PubChem CID 5381024) has the molecular formula C12H8N2O4S2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 3-[(E)-3-amino-2-cyano-3-oxoprop-1-enyl]-1-benzothiophene-2-sulfonic acid.
| Compound Name | 3-[(E)-3-amino-2-cyano-3-oxoprop-1-enyl]-1-benzothiophene-2-sulfonic acid |
|---|---|
| PubChem CID | 5381024 |
| Molecular Formula | C12H8N2O4S2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 3-[(E)-3-amino-2-cyano-3-oxoprop-1-enyl]-1-benzothiophene-2-sulfonic acid |
| SMILES | N#C/C(=C\c1c(S(=O)(=O)O)sc2ccccc12)C(N)=O |
| InChI | InChI=1S/C12H8N2O4S2/c13-6-7(11(14)15)5-9-8-3-1-2-4-10(8)19-12(9)20(16,17)18/h1-5H,(H2,14,15)(H,16,17,18)/b7-5+ |
| InChIKey | TULNRTDBGLXIGW-FNORWQNLSA-N |
| XLogP | 1.54 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|