C20H17Cl2N5O3S — CID 5388027
(4E)-4-(carbamothioylhydrazinylidene)-N,1-bis(4-chloro-2-methylphenyl)-2,5-dioxopyrrolidine-3-carboxamide (PubChem CID 5388027) has the molecular formula C20H17Cl2N5O3S and a molecular weight of 478.36 g/mol. Its IUPAC name is (4E)-4-(carbamothioylhydrazinylidene)-N,1-bis(4-chloro-2-methylphenyl)-2,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | (4E)-4-(carbamothioylhydrazinylidene)-N,1-bis(4-chloro-2-methylphenyl)-2,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 5388027 |
| Molecular Formula | C20H17Cl2N5O3S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | (4E)-4-(carbamothioylhydrazinylidene)-N,1-bis(4-chloro-2-methylphenyl)-2,5-dioxopyrrolidine-3-carboxamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C1C(=O)N(c2ccc(Cl)cc2C)C(=O)/C1=N/NC(N)=S |
| InChI | InChI=1S/C20H17Cl2N5O3S/c1-9-7-11(21)3-5-13(9)24-17(28)15-16(25-26-20(23)31)19(30)27(18(15)29)14-6-4-12(22)8-10(14)2/h3-8,15H,1-2H3,(H,24,28)(H3,23,26,31)/b25-16+ |
| InChIKey | MBJQXDBYLCCINT-PCLIKHOPSA-N |
| XLogP | 2.93 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|