C26H24Cl4N2O3 — CID 5388811
(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-1-(3-morpholin-4-ylpropanoyl)piperidin-4-one (PubChem CID 5388811) has the molecular formula C26H24Cl4N2O3 and a molecular weight of 554.30 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-1-(3-morpholin-4-ylpropanoyl)piperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-1-(3-morpholin-4-ylpropanoyl)piperidin-4-one |
|---|---|
| PubChem CID | 5388811 |
| Molecular Formula | C26H24Cl4N2O3 |
| Molecular Weight | 554.30 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-1-(3-morpholin-4-ylpropanoyl)piperidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)c(Cl)c2)CN(C(=O)CCN2CCOCC2)C/C1=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H24Cl4N2O3/c27-21-3-1-17(13-23(21)29)11-19-15-32(25(33)5-6-31-7-9-35-10-8-31)16-20(26(19)34)12-18-2-4-22(28)24(30)14-18/h1-4,11-14H,5-10,15-16H2/b19-11+,20-12+ |
| InChIKey | NPBPZFGWDSSVAN-AYKLPDECSA-N |
| XLogP | 5.90 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.30 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|