C22H16Cl4O3 — CID 11016147
(7E,9E)-7,9-bis[(3,4-dichlorophenyl)methylidene]-1,4-dioxaspiro[4.5]decan-8-one (PubChem CID 11016147) has the molecular formula C22H16Cl4O3 and a molecular weight of 470.18 g/mol. Its IUPAC name is (7E,9E)-7,9-bis[(3,4-dichlorophenyl)methylidene]-1,4-dioxaspiro[4.5]decan-8-one.
| Compound Name | (7E,9E)-7,9-bis[(3,4-dichlorophenyl)methylidene]-1,4-dioxaspiro[4.5]decan-8-one |
|---|---|
| PubChem CID | 11016147 |
| Molecular Formula | C22H16Cl4O3 |
| Molecular Weight | 470.18 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | (7E,9E)-7,9-bis[(3,4-dichlorophenyl)methylidene]-1,4-dioxaspiro[4.5]decan-8-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)c(Cl)c2)CC2(C/C1=C\c1ccc(Cl)c(Cl)c1)OCCO2 |
| InChI | InChI=1S/C22H16Cl4O3/c23-17-3-1-13(9-19(17)25)7-15-11-22(28-5-6-29-22)12-16(21(15)27)8-14-2-4-18(24)20(26)10-14/h1-4,7-10H,5-6,11-12H2/b15-7+,16-8+ |
| InChIKey | KRJCHLIRNCIYHZ-BGPOSVGRSA-N |
| XLogP | 6.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.18 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|