C14H19NO10 — CID 539106
[4,5-diacetyloxy-2-(1-acetyloxy-2-amino-2-oxoethyl)oxolan-3-yl] acetate (PubChem CID 539106) has the molecular formula C14H19NO10 and a molecular weight of 361.30 g/mol. Its IUPAC name is [4,5-diacetyloxy-2-(1-acetyloxy-2-amino-2-oxoethyl)oxolan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-2-(1-acetyloxy-2-amino-2-oxoethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 539106 |
| Molecular Formula | C14H19NO10 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [4,5-diacetyloxy-2-(1-acetyloxy-2-amino-2-oxoethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1OC(C(OC(C)=O)C(N)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C14H19NO10/c1-5(16)21-10-9(11(13(15)20)22-6(2)17)25-14(24-8(4)19)12(10)23-7(3)18/h9-12,14H,1-4H3,(H2,15,20) |
| InChIKey | PTZFOGOLQYRAEB-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|