C30H31ClN4O4 — CID 54005651
1-[4-[[(3aS,10aR)-10-(2-chloroacetyl)-4-oxo-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-5-yl]methyl]phenyl]-3-[(4-methoxyphenyl)methyl]urea (PubChem CID 54005651) has the molecular formula C30H31ClN4O4 and a molecular weight of 547.06 g/mol. Its IUPAC name is 1-[4-[[(3aS,10aR)-10-(2-chloroacetyl)-4-oxo-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-5-yl]methyl]phenyl]-3-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[4-[[(3aS,10aR)-10-(2-chloroacetyl)-4-oxo-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-5-yl]methyl]phenyl]-3-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 54005651 |
| Molecular Formula | C30H31ClN4O4 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 1-[4-[[(3aS,10aR)-10-(2-chloroacetyl)-4-oxo-2,3,3a,10a-tetrahydro-1H-cyclopenta[b][1,5]benzodiazepin-5-yl]methyl]phenyl]-3-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2ccc(CN3C(=O)[C@H]4CCC[C@H]4N(C(=O)CCl)c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C30H31ClN4O4/c1-39-23-15-11-20(12-16-23)18-32-30(38)33-22-13-9-21(10-14-22)19-34-26-6-2-3-7-27(26)35(28(36)17-31)25-8-4-5-24(25)29(34)37/h2-3,6-7,9-16,24-25H,4-5,8,17-19H2,1H3,(H2,32,33,38)/t24-,25+/m0/s1 |
| InChIKey | KORSXNFXQWXGRU-LOSJGSFVSA-N |
| XLogP | 5.30 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|