C16H12F5N3O2 — CID 54006642
ethyl 2,6-difluoro-N-[[5-(trifluoromethyl)-2-pyridinyl]carbamoyl]benzenecarboximidate (PubChem CID 54006642) has the molecular formula C16H12F5N3O2 and a molecular weight of 373.28 g/mol. Its IUPAC name is ethyl 2,6-difluoro-N-[[5-(trifluoromethyl)-2-pyridinyl]carbamoyl]benzenecarboximidate.
| Compound Name | ethyl 2,6-difluoro-N-[[5-(trifluoromethyl)-2-pyridinyl]carbamoyl]benzenecarboximidate |
|---|---|
| PubChem CID | 54006642 |
| Molecular Formula | C16H12F5N3O2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | ethyl 2,6-difluoro-N-[[5-(trifluoromethyl)-2-pyridinyl]carbamoyl]benzenecarboximidate |
| SMILES | CCOC(=NC(=O)Nc1ccc(C(F)(F)F)cn1)c1c(F)cccc1F |
| InChI | InChI=1S/C16H12F5N3O2/c1-2-26-14(13-10(17)4-3-5-11(13)18)24-15(25)23-12-7-6-9(8-22-12)16(19,20)21/h3-8H,2H2,1H3,(H,22,23,25) |
| InChIKey | KPIQMJQOYNGGCY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|