C21H31NO — CID 54012296
ethane;3-(2,5,6-trimethyl-4-phenyl-3-pyridinyl)propanal (PubChem CID 54012296) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is ethane;3-(2,5,6-trimethyl-4-phenyl-3-pyridinyl)propanal.
| Compound Name | ethane;3-(2,5,6-trimethyl-4-phenyl-3-pyridinyl)propanal |
|---|---|
| PubChem CID | 54012296 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | ethane;3-(2,5,6-trimethyl-4-phenyl-3-pyridinyl)propanal |
| SMILES | CC.CC.Cc1nc(C)c(CCC=O)c(-c2ccccc2)c1C |
| InChI | InChI=1S/C17H19NO.2C2H6/c1-12-13(2)18-14(3)16(10-7-11-19)17(12)15-8-5-4-6-9-15;2*1-2/h4-6,8-9,11H,7,10H2,1-3H3;2*1-2H3 |
| InChIKey | KTEPWOPTQWHDNW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|