C7H15NO3S — CID 54014173
N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide (PubChem CID 54014173) has the molecular formula C7H15NO3S and a molecular weight of 193.27 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 54014173 |
| Molecular Formula | C7H15NO3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide |
| SMILES | O=C(CCS)N(CCO)CCO |
| InChI | InChI=1S/C7H15NO3S/c9-4-2-8(3-5-10)7(11)1-6-12/h9-10,12H,1-6H2 |
| InChIKey | KULUFRRUBMEIHQ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|