C41H26N4O4 — CID 54028342
6-hydroxy-5-[5-(6-hydroxy-5-isocyano-2-oxo-1,4-diphenyl-3-pyridinyl)penta-1,3,4-trienyl]-2-oxo-1,4-diphenylpyridine-3-carbonitrile (PubChem CID 54028342) has the molecular formula C41H26N4O4 and a molecular weight of 638.68 g/mol. Its IUPAC name is 6-hydroxy-5-[5-(6-hydroxy-5-isocyano-2-oxo-1,4-diphenyl-3-pyridinyl)penta-1,3,4-trienyl]-2-oxo-1,4-diphenylpyridine-3-carbonitrile.
| Compound Name | 6-hydroxy-5-[5-(6-hydroxy-5-isocyano-2-oxo-1,4-diphenyl-3-pyridinyl)penta-1,3,4-trienyl]-2-oxo-1,4-diphenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 54028342 |
| Molecular Formula | C41H26N4O4 |
| Molecular Weight | 638.68 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | 6-hydroxy-5-[5-(6-hydroxy-5-isocyano-2-oxo-1,4-diphenyl-3-pyridinyl)penta-1,3,4-trienyl]-2-oxo-1,4-diphenylpyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(-c2ccccc2)c(C=C=CC=Cc2c(-c3ccccc3)c(C#N)c(=O)n(-c3ccccc3)c2O)c(=O)n(-c2ccccc2)c1O |
| InChI | InChI=1S/C41H26N4O4/c1-43-37-36(29-19-9-3-10-20-29)33(39(47)45(41(37)49)31-23-13-5-14-24-31)26-16-6-15-25-32-35(28-17-7-2-8-18-28)34(27-42)40(48)44(38(32)46)30-21-11-4-12-22-30/h2-15,17-26,46,49H |
| InChIKey | UYJHFLXAIAUJPU-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 112.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.68 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|