C19H17Cl2NO4 — CID 54039545
1-(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)pyrrolidine-2,3,5-trione (PubChem CID 54039545) has the molecular formula C19H17Cl2NO4 and a molecular weight of 394.25 g/mol. Its IUPAC name is 1-(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)pyrrolidine-2,3,5-trione.
| Compound Name | 1-(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)pyrrolidine-2,3,5-trione |
|---|---|
| PubChem CID | 54039545 |
| Molecular Formula | C19H17Cl2NO4 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 1-(6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl)pyrrolidine-2,3,5-trione |
| SMILES | CC1(C2CCCC2)Cc2cc(N3C(=O)CC(=O)C3=O)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C19H17Cl2NO4/c1-19(10-4-2-3-5-10)8-9-6-11(15(20)16(21)14(9)17(19)25)22-13(24)7-12(23)18(22)26/h6,10H,2-5,7-8H2,1H3 |
| InChIKey | LLJKKQDKPJJDIK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|