C17H15Cl2NO4 — CID 70496767
1-(6,7-dichloro-2-methyl-1-oxo-2-propyl-3H-inden-5-yl)-3-hydroxypyrrole-2,5-dione (PubChem CID 70496767) has the molecular formula C17H15Cl2NO4 and a molecular weight of 368.22 g/mol. Its IUPAC name is 1-(6,7-dichloro-2-methyl-1-oxo-2-propyl-3H-inden-5-yl)-3-hydroxypyrrole-2,5-dione.
| Compound Name | 1-(6,7-dichloro-2-methyl-1-oxo-2-propyl-3H-inden-5-yl)-3-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 70496767 |
| Molecular Formula | C17H15Cl2NO4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 1-(6,7-dichloro-2-methyl-1-oxo-2-propyl-3H-inden-5-yl)-3-hydroxypyrrole-2,5-dione |
| SMILES | CCCC1(C)Cc2cc(N3C(=O)C=C(O)C3=O)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C17H15Cl2NO4/c1-3-4-17(2)7-8-5-9(13(18)14(19)12(8)15(17)23)20-11(22)6-10(21)16(20)24/h5-6,21H,3-4,7H2,1-2H3 |
| InChIKey | GFTAEHTWOYJCLV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|