C20H13Cl2NO4 — CID 54209063
1-(6,7-dichloro-2-methyl-1-oxo-2-phenyl-3H-inden-5-yl)pyrrolidine-2,3,5-trione (PubChem CID 54209063) has the molecular formula C20H13Cl2NO4 and a molecular weight of 402.23 g/mol. Its IUPAC name is 1-(6,7-dichloro-2-methyl-1-oxo-2-phenyl-3H-inden-5-yl)pyrrolidine-2,3,5-trione.
| Compound Name | 1-(6,7-dichloro-2-methyl-1-oxo-2-phenyl-3H-inden-5-yl)pyrrolidine-2,3,5-trione |
|---|---|
| PubChem CID | 54209063 |
| Molecular Formula | C20H13Cl2NO4 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 1-(6,7-dichloro-2-methyl-1-oxo-2-phenyl-3H-inden-5-yl)pyrrolidine-2,3,5-trione |
| SMILES | CC1(c2ccccc2)Cc2cc(N3C(=O)CC(=O)C3=O)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C20H13Cl2NO4/c1-20(11-5-3-2-4-6-11)9-10-7-12(16(21)17(22)15(10)18(20)26)23-14(25)8-13(24)19(23)27/h2-7H,8-9H2,1H3 |
| InChIKey | PUQHIXLLJUVJHM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|