C20H13Cl2NO4 — CID 70430045
1-(6,7-dichloro-2-methyl-1-oxo-2-phenyl-3H-inden-5-yl)-3-hydroxypyrrole-2,5-dione (PubChem CID 70430045) has the molecular formula C20H13Cl2NO4 and a molecular weight of 402.23 g/mol. Its IUPAC name is 1-(6,7-dichloro-2-methyl-1-oxo-2-phenyl-3H-inden-5-yl)-3-hydroxypyrrole-2,5-dione.
| Compound Name | 1-(6,7-dichloro-2-methyl-1-oxo-2-phenyl-3H-inden-5-yl)-3-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 70430045 |
| Molecular Formula | C20H13Cl2NO4 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 1-(6,7-dichloro-2-methyl-1-oxo-2-phenyl-3H-inden-5-yl)-3-hydroxypyrrole-2,5-dione |
| SMILES | CC1(c2ccccc2)Cc2cc(N3C(=O)C=C(O)C3=O)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C20H13Cl2NO4/c1-20(11-5-3-2-4-6-11)9-10-7-12(16(21)17(22)15(10)18(20)26)23-14(25)8-13(24)19(23)27/h2-8,24H,9H2,1H3 |
| InChIKey | NUJMAGSEGRNEQG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|