C23H25Cl2NO4 — CID 70455166
1-[(3R)-3-butan-2-yl-6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl]-3-hydroxypyrrole-2,5-dione (PubChem CID 70455166) has the molecular formula C23H25Cl2NO4 and a molecular weight of 450.36 g/mol. Its IUPAC name is 1-[(3R)-3-butan-2-yl-6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl]-3-hydroxypyrrole-2,5-dione.
| Compound Name | 1-[(3R)-3-butan-2-yl-6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl]-3-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 70455166 |
| Molecular Formula | C23H25Cl2NO4 |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 1-[(3R)-3-butan-2-yl-6,7-dichloro-2-cyclopentyl-2-methyl-1-oxo-3H-inden-5-yl]-3-hydroxypyrrole-2,5-dione |
| SMILES | CCC(C)[C@@H]1c2cc(N3C(=O)C=C(O)C3=O)c(Cl)c(Cl)c2C(=O)C1(C)C1CCCC1 |
| InChI | InChI=1S/C23H25Cl2NO4/c1-4-11(2)18-13-9-14(26-16(28)10-15(27)22(26)30)19(24)20(25)17(13)21(29)23(18,3)12-7-5-6-8-12/h9-12,18,27H,4-8H2,1-3H3/t11?,18-,23?/m1/s1 |
| InChIKey | CQONUTSHPFTEJH-UWOPPKNGSA-N |
| XLogP | 5.83 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|