C7H13FO4S — CID 54054966
(3S,4S)-1-(2-fluoroethylsulfanyl)-3,4,5-trihydroxypentan-2-one (PubChem CID 54054966) has the molecular formula C7H13FO4S and a molecular weight of 212.24 g/mol. Its IUPAC name is (3S,4S)-1-(2-fluoroethylsulfanyl)-3,4,5-trihydroxypentan-2-one.
| Compound Name | (3S,4S)-1-(2-fluoroethylsulfanyl)-3,4,5-trihydroxypentan-2-one |
|---|---|
| PubChem CID | 54054966 |
| Molecular Formula | C7H13FO4S |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | (3S,4S)-1-(2-fluoroethylsulfanyl)-3,4,5-trihydroxypentan-2-one |
| SMILES | O=C(CSCCF)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C7H13FO4S/c8-1-2-13-4-6(11)7(12)5(10)3-9/h5,7,9-10,12H,1-4H2/t5-,7-/m0/s1 |
| InChIKey | LVOZFWJWRUXSRH-FSPLSTOPSA-N |
| XLogP | -1.03 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|