C7H11F3O5S — CID 123785085
3,4,5,6-tetrahydroxy-1-(trifluoromethylsulfanyl)hexan-2-one (PubChem CID 123785085) has the molecular formula C7H11F3O5S and a molecular weight of 264.22 g/mol. Its IUPAC name is 3,4,5,6-tetrahydroxy-1-(trifluoromethylsulfanyl)hexan-2-one.
| Compound Name | 3,4,5,6-tetrahydroxy-1-(trifluoromethylsulfanyl)hexan-2-one |
|---|---|
| PubChem CID | 123785085 |
| Molecular Formula | C7H11F3O5S |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 3,4,5,6-tetrahydroxy-1-(trifluoromethylsulfanyl)hexan-2-one |
| SMILES | O=C(CSC(F)(F)F)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C7H11F3O5S/c8-7(9,10)16-2-4(13)6(15)5(14)3(12)1-11/h3,5-6,11-12,14-15H,1-2H2 |
| InChIKey | DLBVSKNYDFHYON-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |