C19H26F18 — CID 54056623
ethane;heptane;1,1,1,2,4,5,5,5-octafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-4-(trifluoromethyl)pentane (PubChem CID 54056623) has the molecular formula C19H26F18 and a molecular weight of 596.38 g/mol. Its IUPAC name is ethane;heptane;1,1,1,2,4,5,5,5-octafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-4-(trifluoromethyl)pentane.
| Compound Name | ethane;heptane;1,1,1,2,4,5,5,5-octafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-4-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 54056623 |
| Molecular Formula | C19H26F18 |
| Molecular Weight | 596.38 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | ethane;heptane;1,1,1,2,4,5,5,5-octafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-4-(trifluoromethyl)pentane |
| SMILES | CC.CC(F)(C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F.CCCCCCC |
| InChI | InChI=1S/C10H4F18.C7H16.C2H6/c1-3(11,6(14,15)16)2(4(12,7(17,18)19)8(20,21)22)5(13,9(23,24)25)10(26,27)28;1-3-5-7-6-4-2;1-2/h2H,1H3;3-7H2,1-2H3;1-2H3 |
| InChIKey | LWSFTVZFNMYPOW-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.38 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|