C22H25N5O2 — CID 54060274
3-(4-oxo-6-propan-2-ylquinazolin-3-yl)-N-[3-(pyridin-2-ylamino)propyl]prop-2-enamide (PubChem CID 54060274) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 3-(4-oxo-6-propan-2-ylquinazolin-3-yl)-N-[3-(pyridin-2-ylamino)propyl]prop-2-enamide.
| Compound Name | 3-(4-oxo-6-propan-2-ylquinazolin-3-yl)-N-[3-(pyridin-2-ylamino)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 54060274 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3-(4-oxo-6-propan-2-ylquinazolin-3-yl)-N-[3-(pyridin-2-ylamino)propyl]prop-2-enamide |
| SMILES | CC(C)c1ccc2ncn(C=CC(=O)NCCCNc3ccccn3)c(=O)c2c1 |
| InChI | InChI=1S/C22H25N5O2/c1-16(2)17-7-8-19-18(14-17)22(29)27(15-26-19)13-9-21(28)25-12-5-11-24-20-6-3-4-10-23-20/h3-4,6-10,13-16H,5,11-12H2,1-2H3,(H,23,24)(H,25,28) |
| InChIKey | LZEZELWIXJQWNI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|