C16H30N2O — CID 54065889
2,12,12-trimethyl-13-nitrosotrideca-5,9-dien-3-amine (PubChem CID 54065889) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 2,12,12-trimethyl-13-nitrosotrideca-5,9-dien-3-amine.
| Compound Name | 2,12,12-trimethyl-13-nitrosotrideca-5,9-dien-3-amine |
|---|---|
| PubChem CID | 54065889 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2,12,12-trimethyl-13-nitrosotrideca-5,9-dien-3-amine |
| SMILES | CC(C)C(N)CC=CCCC=CCC(C)(C)CN=O |
| InChI | InChI=1S/C16H30N2O/c1-14(2)15(17)11-9-7-5-6-8-10-12-16(3,4)13-18-19/h7-10,14-15H,5-6,11-13,17H2,1-4H3 |
| InChIKey | MCYCMVPVBUUCSO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|