C17H32N4O — CID 54254998
[(11-amino-2,2,12-trimethyltrideca-4,8-dienylidene)amino]urea (PubChem CID 54254998) has the molecular formula C17H32N4O and a molecular weight of 308.47 g/mol. Its IUPAC name is [(11-amino-2,2,12-trimethyltrideca-4,8-dienylidene)amino]urea.
| Compound Name | [(11-amino-2,2,12-trimethyltrideca-4,8-dienylidene)amino]urea |
|---|---|
| PubChem CID | 54254998 |
| Molecular Formula | C17H32N4O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | [(11-amino-2,2,12-trimethyltrideca-4,8-dienylidene)amino]urea |
| SMILES | CC(C)C(N)CC=CCCC=CCC(C)(C)C=NNC(N)=O |
| InChI | InChI=1S/C17H32N4O/c1-14(2)15(18)11-9-7-5-6-8-10-12-17(3,4)13-20-21-16(19)22/h7-10,13-15H,5-6,11-12,18H2,1-4H3,(H3,19,21,22) |
| InChIKey | QZJXNWWCWNAMMS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|