C14H9F6NO3 — CID 54070063
2-[3,5-bis(trifluoromethyl)phenyl]-N-(5-oxo-2H-furan-3-yl)acetamide (PubChem CID 54070063) has the molecular formula C14H9F6NO3 and a molecular weight of 353.22 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-N-(5-oxo-2H-furan-3-yl)acetamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-(5-oxo-2H-furan-3-yl)acetamide |
|---|---|
| PubChem CID | 54070063 |
| Molecular Formula | C14H9F6NO3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-(5-oxo-2H-furan-3-yl)acetamide |
| SMILES | O=C(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)NC1=CC(=O)OC1 |
| InChI | InChI=1S/C14H9F6NO3/c15-13(16,17)8-1-7(2-9(4-8)14(18,19)20)3-11(22)21-10-5-12(23)24-6-10/h1-2,4-5H,3,6H2,(H,21,22) |
| InChIKey | MFUMQKOOOXSMQX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |