C28H46O6 — CID 54073529
[3-(2-ethylhexanoylperoxy)-3-methylbutyl] 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 54073529) has the molecular formula C28H46O6 and a molecular weight of 478.67 g/mol. Its IUPAC name is [3-(2-ethylhexanoylperoxy)-3-methylbutyl] 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | [3-(2-ethylhexanoylperoxy)-3-methylbutyl] 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 54073529 |
| Molecular Formula | C28H46O6 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | [3-(2-ethylhexanoylperoxy)-3-methylbutyl] 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | CCCCC(CC)C(=O)OOC(C)(C)CCOC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H46O6/c1-11-13-14-19(12-2)25(31)33-34-28(9,10)15-16-32-24(30)20-17-21(26(3,4)5)23(29)22(18-20)27(6,7)8/h17-19,29H,11-16H2,1-10H3 |
| InChIKey | MICQXGUKNNHGLG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|