C14H18O3 — CID 54075797
1-(2,4-dihydroxy-5-prop-1-enyl-3-propylphenyl)ethanone (PubChem CID 54075797) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 1-(2,4-dihydroxy-5-prop-1-enyl-3-propylphenyl)ethanone.
| Compound Name | 1-(2,4-dihydroxy-5-prop-1-enyl-3-propylphenyl)ethanone |
|---|---|
| PubChem CID | 54075797 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1-(2,4-dihydroxy-5-prop-1-enyl-3-propylphenyl)ethanone |
| SMILES | CC=Cc1cc(C(C)=O)c(O)c(CCC)c1O |
| InChI | InChI=1S/C14H18O3/c1-4-6-10-8-12(9(3)15)14(17)11(7-5-2)13(10)16/h4,6,8,16-17H,5,7H2,1-3H3 |
| InChIKey | MJOTVVAUMGEQDB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |